C14H18O2 — CID 107684696
5-(2-cyclopropylethoxy)-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684696) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-(2-cyclopropylethoxy)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-(2-cyclopropylethoxy)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684696 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-(2-cyclopropylethoxy)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2cc(OCCC3CC3)ccc21 |
| InChI | InChI=1S/C14H18O2/c15-14-6-3-11-9-12(4-5-13(11)14)16-8-7-10-1-2-10/h4-5,9-10,14-15H,1-3,6-8H2 |
| InChIKey | QVDHQAWGGMRFHQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |