C12H16O3 — CID 107684542
5-(3-hydroxypropoxy)-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684542) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-(3-hydroxypropoxy)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-(3-hydroxypropoxy)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684542 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5-(3-hydroxypropoxy)-2,3-dihydro-1H-inden-1-ol |
| SMILES | OCCCOc1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C12H16O3/c13-6-1-7-15-10-3-4-11-9(8-10)2-5-12(11)14/h3-4,8,12-14H,1-2,5-7H2 |
| InChIKey | MUINSOHIMDIMNT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|