C15H19NO — CID 107683611
5-but-2-ynoxy-N-ethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 107683611) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is 5-but-2-ynoxy-N-ethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-but-2-ynoxy-N-ethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 107683611 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 5-but-2-ynoxy-N-ethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC#CCOc1ccc2c(c1)CCC2NCC |
| InChI | InChI=1S/C15H19NO/c1-3-5-10-17-13-7-8-14-12(11-13)6-9-15(14)16-4-2/h7-8,11,15-16H,4,6,9-10H2,1-2H3 |
| InChIKey | SLSYUZRNGAIZKF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|