C16H21NO — CID 107683662
N-ethyl-5-pent-4-ynoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 107683662) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-ethyl-5-pent-4-ynoxy-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-ethyl-5-pent-4-ynoxy-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 107683662 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-ethyl-5-pent-4-ynoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCCCOc1ccc2c(c1)CCC2NCC |
| InChI | InChI=1S/C16H21NO/c1-3-5-6-11-18-14-8-9-15-13(12-14)7-10-16(15)17-4-2/h1,8-9,12,16-17H,4-7,10-11H2,2H3 |
| InChIKey | MAAPJZQIBBTWEK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|