C13H15NO — CID 130014165
5-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 130014165) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 5-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 130014165 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 5-methoxy-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCNC1CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C13H15NO/c1-3-8-14-13-7-4-10-9-11(15-2)5-6-12(10)13/h1,5-6,9,13-14H,4,7-8H2,2H3 |
| InChIKey | GKAXZCMNXZOIBF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|