C13H15NO2 — CID 53378998
formic acid;(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 53378998) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is formic acid;(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | formic acid;(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 53378998 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | formic acid;(1S)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCN[C@H]1CCc2ccccc21.O=CO |
| InChI | InChI=1S/C12H13N.CH2O2/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12;2-1-3/h1,3-6,12-13H,7-9H2;1H,(H,2,3)/t12-;/m0./s1 |
| InChIKey | DBYYVOLIBGTJLE-YDALLXLXSA-N |
| XLogP | 1.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|