C16H19NO4 — CID 44611628
butanedioic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 44611628) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is butanedioic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | butanedioic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 44611628 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | butanedioic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCN[C@@H]1CCc2ccccc21.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C12H13N.C4H6O4/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12;5-3(6)1-2-4(7)8/h1,3-6,12-13H,7-9H2;1-2H2,(H,5,6)(H,7,8)/t12-;/m1./s1 |
| InChIKey | MGKZZAMATYBIIL-UTONKHPSSA-N |
| XLogP | 1.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|