3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid

C12H15NO2 — CID 43088449

IUPAC3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid
SMILESO=C(O)CCNC1CCc2ccccc21
InChIInChI=1S/C12H15NO2/c14-12(15)7-8-13-11-6-5-9-3-1-2-4-10(9)11/h1-4,11,13H,5-8H2,(H,14,15)
InChIKeyQROSQRYTOXIIME-UHFFFAOYSA-N
MW205.26 g/mol
LogP1.74
Rot. Bonds4

About 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid

3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid (PubChem CID 43088449) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid.

Molecular Properties

Compound Name3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid
PubChem CID43088449
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Name3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid
SMILESO=C(O)CCNC1CCc2ccccc21
InChIInChI=1S/C12H15NO2/c14-12(15)7-8-13-11-6-5-9-3-1-2-4-10(9)11/h1-4,11,13H,5-8H2,(H,14,15)
InChIKeyQROSQRYTOXIIME-UHFFFAOYSA-N
XLogP1.74
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 51.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid?
The IUPAC name of 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid (CID 43088449) is 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid.
What is the SMILES notation for 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid?
The canonical SMILES for 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid is O=C(O)CCNC1CCc2ccccc21.
What is the InChIKey of 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid?
The InChIKey is QROSQRYTOXIIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-12(15)7-8-13-11-6-5-9-3-1-2-4-10(9)11/h1-4,11,13H,5-8H2,(H,14,15).
What are the key properties of 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid?
3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid has a molecular weight of 205.26 g/mol, XLogP of 1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-inden-1-ylamino)propanoic acid is sourced from PubChem (CID 43088449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).