C13H18N2O — CID 43206104
N-[2-(2,3-dihydro-1H-inden-1-ylamino)ethyl]acetamide (PubChem CID 43206104) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-1-ylamino)ethyl]acetamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-1-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 43206104 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-1-ylamino)ethyl]acetamide |
| SMILES | CC(=O)NCCNC1CCc2ccccc21 |
| InChI | InChI=1S/C13H18N2O/c1-10(16)14-8-9-15-13-7-6-11-4-2-3-5-12(11)13/h2-5,13,15H,6-9H2,1H3,(H,14,16) |
| InChIKey | WFBSYLODZRZGMM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|