C13H19NO4S — CID 140668931
methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrate (PubChem CID 140668931) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrate.
| Compound Name | methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrate |
|---|---|
| PubChem CID | 140668931 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methanesulfonic acid;(1R)-N-prop-2-ynyl-2,3-dihydro-1H-inden-1-amine;hydrate |
| SMILES | C#CCN[C@@H]1CCc2ccccc21.CS(=O)(=O)O.O |
| InChI | InChI=1S/C12H13N.CH4O3S.H2O/c1-2-9-13-12-8-7-10-5-3-4-6-11(10)12;1-5(2,3)4;/h1,3-6,12-13H,7-9H2;1H3,(H,2,3,4);1H2/t12-;;/m1../s1 |
| InChIKey | QFNSJVVPMQGQIZ-CURYUGHLSA-N |
| XLogP | 0.58 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|