C14H17N — CID 115724846
N-pent-4-ynyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 115724846) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-pent-4-ynyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-pent-4-ynyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 115724846 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-pent-4-ynyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | C#CCCCNC1CCc2ccccc21 |
| InChI | InChI=1S/C14H17N/c1-2-3-6-11-15-14-10-9-12-7-4-5-8-13(12)14/h1,4-5,7-8,14-15H,3,6,9-11H2 |
| InChIKey | UAXPWJAFCUPUQJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|