C15H19NS — CID 103903582
N-hex-5-ynyl-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 103903582) has the molecular formula C15H19NS and a molecular weight of 245.39 g/mol. Its IUPAC name is N-hex-5-ynyl-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-hex-5-ynyl-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 103903582 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-hex-5-ynyl-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | C#CCCCCNC1CCSc2ccccc21 |
| InChI | InChI=1S/C15H19NS/c1-2-3-4-7-11-16-14-10-12-17-15-9-6-5-8-13(14)15/h1,5-6,8-9,14,16H,3-4,7,10-12H2 |
| InChIKey | HQPUQJSHPHOHKY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|