C12H17NO2S — CID 60658466
3-(3,4-dihydro-2H-thiochromen-4-ylamino)propane-1,2-diol (PubChem CID 60658466) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-thiochromen-4-ylamino)propane-1,2-diol.
| Compound Name | 3-(3,4-dihydro-2H-thiochromen-4-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 60658466 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-(3,4-dihydro-2H-thiochromen-4-ylamino)propane-1,2-diol |
| SMILES | OCC(O)CNC1CCSc2ccccc21 |
| InChI | InChI=1S/C12H17NO2S/c14-8-9(15)7-13-11-5-6-16-12-4-2-1-3-10(11)12/h1-4,9,11,13-15H,5-8H2 |
| InChIKey | MDWQJYGDZYGABM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |