2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid

C11H13NO2S — CID 43135138

IUPAC2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid
SMILESO=C(O)CNC1CCSc2ccccc21
InChIInChI=1S/C11H13NO2S/c13-11(14)7-12-9-5-6-15-10-4-2-1-3-8(9)10/h1-4,9,12H,5-7H2,(H,13,14)
InChIKeyCDCBFACCKAOTKL-UHFFFAOYSA-N
MW223.30 g/mol
LogP1.90
Rot. Bonds3

About 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid

2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid (PubChem CID 43135138) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid.

Molecular Properties

Compound Name2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid
PubChem CID43135138
Molecular FormulaC11H13NO2S
Molecular Weight223.30 g/mol
Exact Mass223.07
IUPAC Name2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid
SMILESO=C(O)CNC1CCSc2ccccc21
InChIInChI=1S/C11H13NO2S/c13-11(14)7-12-9-5-6-15-10-4-2-1-3-8(9)10/h1-4,9,12H,5-7H2,(H,13,14)
InChIKeyCDCBFACCKAOTKL-UHFFFAOYSA-N
XLogP1.90
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.30
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid?
The IUPAC name of 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid (CID 43135138) is 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid.
What is the SMILES notation for 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid?
The canonical SMILES for 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid is O=C(O)CNC1CCSc2ccccc21.
What is the InChIKey of 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid?
The InChIKey is CDCBFACCKAOTKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2S/c13-11(14)7-12-9-5-6-15-10-4-2-1-3-8(9)10/h1-4,9,12H,5-7H2,(H,13,14).
What are the key properties of 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid?
2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid has a molecular weight of 223.30 g/mol, XLogP of 1.90, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-thiochromen-4-ylamino)acetic acid is sourced from PubChem (CID 43135138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).