C14H18N4S — CID 64548240
N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3,4-dihydro-2H-thiochromen-4-amine (PubChem CID 64548240) has the molecular formula C14H18N4S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3,4-dihydro-2H-thiochromen-4-amine.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3,4-dihydro-2H-thiochromen-4-amine |
|---|---|
| PubChem CID | 64548240 |
| Molecular Formula | C14H18N4S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3,4-dihydro-2H-thiochromen-4-amine |
| SMILES | c1ccc2c(c1)SCCC2NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C14H18N4S/c1-2-5-13-11(4-1)12(7-9-19-13)15-8-3-6-14-16-10-17-18-14/h1-2,4-5,10,12,15H,3,6-9H2,(H,16,17,18) |
| InChIKey | MJNNLIOAAQZTNS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|