C17H22N4OS — CID 71894079
1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea (PubChem CID 71894079) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea.
| Compound Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 71894079 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
| SMILES | Cc1[nH]ncc1CCCNC(=O)NC1CCSc2ccccc21 |
| InChI | InChI=1S/C17H22N4OS/c1-12-13(11-19-21-12)5-4-9-18-17(22)20-15-8-10-23-16-7-3-2-6-14(15)16/h2-3,6-7,11,15H,4-5,8-10H2,1H3,(H,19,21)(H2,18,20,22) |
| InChIKey | FOIHIMPQWNRHFC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|