C12H20N4O3S — CID 95133447
1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea (PubChem CID 95133447) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea.
| Compound Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 95133447 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
| SMILES | Cc1[nH]ncc1CCCNC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N4O3S/c1-9-10(7-14-16-9)3-2-5-13-12(17)15-11-4-6-20(18,19)8-11/h7,11H,2-6,8H2,1H3,(H,14,16)(H2,13,15,17)/t11-/m1/s1 |
| InChIKey | YHNAOMWZOIUVDQ-LLVKDONJSA-N |
| XLogP | 0.14 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|