C15H22N4O2 — CID 62039009
1-cyclopropyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 62039009) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-cyclopropyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cyclopropyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 62039009 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-cyclopropyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1[nH]ncc1CCCNC(=O)C1CC(=O)N(C2CC2)C1 |
| InChI | InChI=1S/C15H22N4O2/c1-10-11(8-17-18-10)3-2-6-16-15(21)12-7-14(20)19(9-12)13-4-5-13/h8,12-13H,2-7,9H2,1H3,(H,16,21)(H,17,18) |
| InChIKey | WOWGWTRKQSURSN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|