C13H22N4O — CID 114084882
(3S,4S)-4-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrrolidine-3-carboxamide (PubChem CID 114084882) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is (3S,4S)-4-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-4-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114084882 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | (3S,4S)-4-methyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1[nH]ncc1CCCNC(=O)[C@@H]1CNC[C@H]1C |
| InChI | InChI=1S/C13H22N4O/c1-9-6-14-8-12(9)13(18)15-5-3-4-11-7-16-17-10(11)2/h7,9,12,14H,3-6,8H2,1-2H3,(H,15,18)(H,16,17)/t9-,12-/m1/s1 |
| InChIKey | FSCKGYXIMOEUHE-BXKDBHETSA-N |
| XLogP | 0.62 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|