C15H27N5O — CID 97308171
(2S,3S)-2,3,4-trimethyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboxamide (PubChem CID 97308171) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is (2S,3S)-2,3,4-trimethyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboxamide.
| Compound Name | (2S,3S)-2,3,4-trimethyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 97308171 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (2S,3S)-2,3,4-trimethyl-N-[3-(5-methyl-1H-pyrazol-4-yl)propyl]piperazine-1-carboxamide |
| SMILES | Cc1[nH]ncc1CCCNC(=O)N1CCN(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C15H27N5O/c1-11-14(10-17-18-11)6-5-7-16-15(21)20-9-8-19(4)12(2)13(20)3/h10,12-13H,5-9H2,1-4H3,(H,16,21)(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | MRWRIUNMJVPLOK-STQMWFEESA-N |
| XLogP | 1.38 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|