C19H22N2O3S — CID 51935223
1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(4-methoxyphenoxy)ethyl]urea (PubChem CID 51935223) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(4-methoxyphenoxy)ethyl]urea.
| Compound Name | 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(4-methoxyphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 51935223 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-[2-(4-methoxyphenoxy)ethyl]urea |
| SMILES | COc1ccc(OCCNC(=O)N[C@@H]2CCSc3ccccc32)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-23-14-6-8-15(9-7-14)24-12-11-20-19(22)21-17-10-13-25-18-5-3-2-4-16(17)18/h2-9,17H,10-13H2,1H3,(H2,20,21,22)/t17-/m1/s1 |
| InChIKey | IKFKYSRURSAXRJ-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|