C18H20N2O2S — CID 42952530
1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 42952530) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42952530 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-thiochromen-4-yl)-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)NC2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-22-14-6-4-5-13(11-14)12-19-18(21)20-16-9-10-23-17-8-3-2-7-15(16)17/h2-8,11,16H,9-10,12H2,1H3,(H2,19,20,21) |
| InChIKey | ZKFULKHMWNQREL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |