C16H17N3OS — CID 94054830
1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(pyridin-4-ylmethyl)urea (PubChem CID 94054830) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 94054830 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccncc1)N[C@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C16H17N3OS/c20-16(18-11-12-5-8-17-9-6-12)19-14-7-10-21-15-4-2-1-3-13(14)15/h1-6,8-9,14H,7,10-11H2,(H2,18,19,20)/t14-/m0/s1 |
| InChIKey | GWIWKARDTBQRBB-AWEZNQCLSA-N |
| XLogP | 3.12 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |