C19H17N3OS — CID 94515114
1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-isoquinolin-5-ylurea (PubChem CID 94515114) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 94515114 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(Nc1cccc2cnccc12)N[C@@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C19H17N3OS/c23-19(21-16-6-3-4-13-12-20-10-8-14(13)16)22-17-9-11-24-18-7-2-1-5-15(17)18/h1-8,10,12,17H,9,11H2,(H2,21,22,23)/t17-/m1/s1 |
| InChIKey | PKJPDIQLFSHGPO-QGZVFWFLSA-N |
| XLogP | 4.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |