C19H21N5O2 — CID 72844286
1-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methyl]-3-isoquinolin-5-ylurea (PubChem CID 72844286) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methyl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methyl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 72844286 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-[(3-cyclohexyl-1,2,4-oxadiazol-5-yl)methyl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(NCc1nc(C2CCCCC2)no1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C19H21N5O2/c25-19(22-16-8-4-7-14-11-20-10-9-15(14)16)21-12-17-23-18(24-26-17)13-5-2-1-3-6-13/h4,7-11,13H,1-3,5-6,12H2,(H2,21,22,25) |
| InChIKey | FDAFKMDJYSKMJP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |