C17H15BrFN3O — CID 142686095
1-[(4-bromo-4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-isoquinolin-5-ylurea (PubChem CID 142686095) has the molecular formula C17H15BrFN3O and a molecular weight of 376.23 g/mol. Its IUPAC name is 1-[(4-bromo-4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[(4-bromo-4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 142686095 |
| Molecular Formula | C17H15BrFN3O |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 1-[(4-bromo-4-fluorocyclohexa-1,5-dien-1-yl)methyl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(NCC1=CCC(F)(Br)C=C1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C17H15BrFN3O/c18-17(19)7-4-12(5-8-17)10-21-16(23)22-15-3-1-2-13-11-20-9-6-14(13)15/h1-7,9,11H,8,10H2,(H2,21,22,23) |
| InChIKey | PMTYBQKDWWXJDQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|