C19H16FN3O2 — CID 25264620
1-[(4R)-6-fluoro-3,4-dihydro-2H-chromen-4-yl]-3-isoquinolin-5-ylurea (PubChem CID 25264620) has the molecular formula C19H16FN3O2 and a molecular weight of 337.35 g/mol. Its IUPAC name is 1-[(4R)-6-fluoro-3,4-dihydro-2H-chromen-4-yl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[(4R)-6-fluoro-3,4-dihydro-2H-chromen-4-yl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 25264620 |
| Molecular Formula | C19H16FN3O2 |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[(4R)-6-fluoro-3,4-dihydro-2H-chromen-4-yl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(Nc1cccc2cnccc12)N[C@@H]1CCOc2ccc(F)cc21 |
| InChI | InChI=1S/C19H16FN3O2/c20-13-4-5-18-15(10-13)17(7-9-25-18)23-19(24)22-16-3-1-2-12-11-21-8-6-14(12)16/h1-6,8,10-11,17H,7,9H2,(H2,22,23,24)/t17-/m1/s1 |
| InChIKey | YIDXTTBTOVGXQW-QGZVFWFLSA-N |
| XLogP | 4.02 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |