C17H18N2S2 — CID 26873392
1-benzyl-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]thiourea (PubChem CID 26873392) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 1-benzyl-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]thiourea.
| Compound Name | 1-benzyl-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]thiourea |
|---|---|
| PubChem CID | 26873392 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-benzyl-3-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]thiourea |
| SMILES | S=C(NCc1ccccc1)N[C@@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C17H18N2S2/c20-17(18-12-13-6-2-1-3-7-13)19-15-10-11-21-16-9-5-4-8-14(15)16/h1-9,15H,10-12H2,(H2,18,19,20)/t15-/m1/s1 |
| InChIKey | XZJBTVHABBDODG-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|