C17H17ClN2S2 — CID 42921691
1-benzyl-3-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)thiourea (PubChem CID 42921691) has the molecular formula C17H17ClN2S2 and a molecular weight of 348.92 g/mol. Its IUPAC name is 1-benzyl-3-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)thiourea.
| Compound Name | 1-benzyl-3-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)thiourea |
|---|---|
| PubChem CID | 42921691 |
| Molecular Formula | C17H17ClN2S2 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 1-benzyl-3-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)thiourea |
| SMILES | S=C(NCc1ccccc1)NC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H17ClN2S2/c18-13-6-7-16-14(10-13)15(8-9-22-16)20-17(21)19-11-12-4-2-1-3-5-12/h1-7,10,15H,8-9,11H2,(H2,19,20,21) |
| InChIKey | BBCUEUKGFXZVSX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|