C16H15Cl2NOS — CID 43723360
4-chloro-2-[[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]phenol (PubChem CID 43723360) has the molecular formula C16H15Cl2NOS and a molecular weight of 340.28 g/mol. Its IUPAC name is 4-chloro-2-[[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]phenol.
| Compound Name | 4-chloro-2-[[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 43723360 |
| Molecular Formula | C16H15Cl2NOS |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 4-chloro-2-[[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]methyl]phenol |
| SMILES | Oc1ccc(Cl)cc1CNC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H15Cl2NOS/c17-11-1-3-15(20)10(7-11)9-19-14-5-6-21-16-4-2-12(18)8-13(14)16/h1-4,7-8,14,19-20H,5-6,9H2 |
| InChIKey | QRWFCZLBUIEKFQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|