C12H16ClN3OS — CID 83111726
2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylurea (PubChem CID 83111726) has the molecular formula C12H16ClN3OS and a molecular weight of 285.80 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylurea.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83111726 |
| Molecular Formula | C12H16ClN3OS |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H16ClN3OS/c13-8-1-2-11-9(7-8)10(3-6-18-11)15-4-5-16-12(14)17/h1-2,7,10,15H,3-6H2,(H3,14,16,17) |
| InChIKey | YJMOXSPLZOSBMH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|