C14H18ClN3O2S — CID 97079525
4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]butanamide (PubChem CID 97079525) has the molecular formula C14H18ClN3O2S and a molecular weight of 327.84 g/mol. Its IUPAC name is 4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]butanamide.
| Compound Name | 4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]butanamide |
|---|---|
| PubChem CID | 97079525 |
| Molecular Formula | C14H18ClN3O2S |
| Molecular Weight | 327.84 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[[(4R)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]carbamoylamino]butanamide |
| SMILES | NC(=O)CCCNC(=O)N[C@@H]1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H18ClN3O2S/c15-9-3-4-12-10(8-9)11(5-7-21-12)18-14(20)17-6-1-2-13(16)19/h3-4,8,11H,1-2,5-7H2,(H2,16,19)(H2,17,18,20)/t11-/m1/s1 |
| InChIKey | DCUPMUQGFARMQL-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.84 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|