C15H21ClN2OS — CID 43709288
6-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide (PubChem CID 43709288) has the molecular formula C15H21ClN2OS and a molecular weight of 312.87 g/mol. Its IUPAC name is 6-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide.
| Compound Name | 6-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide |
|---|---|
| PubChem CID | 43709288 |
| Molecular Formula | C15H21ClN2OS |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 6-amino-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)hexanamide |
| SMILES | NCCCCCC(=O)NC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H21ClN2OS/c16-11-5-6-14-12(10-11)13(7-9-20-14)18-15(19)4-2-1-3-8-17/h5-6,10,13H,1-4,7-9,17H2,(H,18,19) |
| InChIKey | DVLDNDLXFKPMJL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|