C19H24ClN3O4S2 — CID 25480480
5-[(3aR,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(4S)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]pentanamide (PubChem CID 25480480) has the molecular formula C19H24ClN3O4S2 and a molecular weight of 458.01 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(4S)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]pentanamide.
| Compound Name | 5-[(3aR,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(4S)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]pentanamide |
|---|---|
| PubChem CID | 25480480 |
| Molecular Formula | C19H24ClN3O4S2 |
| Molecular Weight | 458.01 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 5-[(3aR,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(4S)-6-chloro-3,4-dihydro-2H-thiochromen-4-yl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1[C@@H]2NC(=O)N[C@@H]2CS1(=O)=O)N[C@H]1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H24ClN3O4S2/c20-11-5-6-15-12(9-11)13(7-8-28-15)21-17(24)4-2-1-3-16-18-14(10-29(16,26)27)22-19(25)23-18/h5-6,9,13-14,16,18H,1-4,7-8,10H2,(H,21,24)(H2,22,23,25)/t13-,14+,16+,18+/m0/s1 |
| InChIKey | KPZCILVYMAKUFD-GARXJVFOSA-N |
| XLogP | 2.40 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.01 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|