C16H19ClFN3O4S — CID 42926799
N-(2-chloro-4-fluorophenyl)-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 42926799) has the molecular formula C16H19ClFN3O4S and a molecular weight of 403.86 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 42926799 |
| Molecular Formula | C16H19ClFN3O4S |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCCC1C2NC(=O)NC2CS1(=O)=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H19ClFN3O4S/c17-10-7-9(18)5-6-11(10)19-14(22)4-2-1-3-13-15-12(8-26(13,24)25)20-16(23)21-15/h5-7,12-13,15H,1-4,8H2,(H,19,22)(H2,20,21,23) |
| InChIKey | GZTHCRMASPJMQY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|