C17H19BrF3N3O4S — CID 124736839
5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-bromo-3-(trifluoromethyl)phenyl]pentanamide (PubChem CID 124736839) has the molecular formula C17H19BrF3N3O4S and a molecular weight of 498.32 g/mol. Its IUPAC name is 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-bromo-3-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-bromo-3-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 124736839 |
| Molecular Formula | C17H19BrF3N3O4S |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-bromo-3-(trifluoromethyl)phenyl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1[C@H]2NC(=O)N[C@H]2CS1(=O)=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19BrF3N3O4S/c18-11-6-5-9(7-10(11)17(19,20)21)22-14(25)4-2-1-3-13-15-12(8-29(13,27)28)23-16(26)24-15/h5-7,12-13,15H,1-4,8H2,(H,22,25)(H2,23,24,26)/t12-,13+,15-/m0/s1 |
| InChIKey | PDUBPLWHUAFYKU-GUTXKFCHSA-N |
| XLogP | 2.81 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|