C16H15F5N2O5S — CID 4182223
(2,3,4,5,6-pentafluorophenyl) 5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 4182223) has the molecular formula C16H15F5N2O5S and a molecular weight of 442.36 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 4182223 |
| Molecular Formula | C16H15F5N2O5S |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | O=C1NC2CS(=O)(=O)C(CCCCC(=O)Oc3c(F)c(F)c(F)c(F)c3F)C2N1 |
| InChI | InChI=1S/C16H15F5N2O5S/c17-9-10(18)12(20)15(13(21)11(9)19)28-8(24)4-2-1-3-7-14-6(5-29(7,26)27)22-16(25)23-14/h6-7,14H,1-5H2,(H2,22,23,25) |
| InChIKey | DXHJJRPOMMYGRY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|