C17H22ClN3O4S — CID 124742033
5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-chloro-4-methylphenyl)pentanamide (PubChem CID 124742033) has the molecular formula C17H22ClN3O4S and a molecular weight of 399.90 g/mol. Its IUPAC name is 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-chloro-4-methylphenyl)pentanamide.
| Compound Name | 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-chloro-4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 124742033 |
| Molecular Formula | C17H22ClN3O4S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-chloro-4-methylphenyl)pentanamide |
| SMILES | Cc1ccc(NC(=O)CCCC[C@@H]2[C@H]3NC(=O)N[C@H]3CS2(=O)=O)cc1Cl |
| InChI | InChI=1S/C17H22ClN3O4S/c1-10-6-7-11(8-12(10)18)19-15(22)5-3-2-4-14-16-13(9-26(14,24)25)20-17(23)21-16/h6-8,13-14,16H,2-5,9H2,1H3,(H,19,22)(H2,20,21,23)/t13-,14+,16-/m0/s1 |
| InChIKey | XDAUMOHMXKVLKH-LZWOXQAQSA-N |
| XLogP | 1.99 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|