C30H37ClN4O7S — CID 59583683
N-[6-[[(E)-3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoyl]amino]hexyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 59583683) has the molecular formula C30H37ClN4O7S and a molecular weight of 633.17 g/mol. Its IUPAC name is N-[6-[[(E)-3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoyl]amino]hexyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[6-[[(E)-3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoyl]amino]hexyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 59583683 |
| Molecular Formula | C30H37ClN4O7S |
| Molecular Weight | 633.17 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | N-[6-[[(E)-3-(3-chloro-1,4-dioxonaphthalen-2-yl)-2-methylprop-2-enoyl]amino]hexyl]-5-(2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | C/C(=C\C1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)NCCCCCCNC(=O)CCCCC1C2NC(=O)NC2CS1(=O)=O |
| InChI | InChI=1S/C30H37ClN4O7S/c1-18(16-21-25(31)28(38)20-11-5-4-10-19(20)27(21)37)29(39)33-15-9-3-2-8-14-32-24(36)13-7-6-12-23-26-22(17-43(23,41)42)34-30(40)35-26/h4-5,10-11,16,22-23,26H,2-3,6-9,12-15,17H2,1H3,(H,32,36)(H,33,39)(H2,34,35,40)/b18-16+ |
| InChIKey | TWXMITZLUSCCIE-FBMGVBCBSA-N |
| XLogP | 2.70 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.17 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|