C21H26ClN5O4S — CID 51885694
5-[(3aS,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]pentanamide (PubChem CID 51885694) has the molecular formula C21H26ClN5O4S and a molecular weight of 479.99 g/mol. Its IUPAC name is 5-[(3aS,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]pentanamide.
| Compound Name | 5-[(3aS,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 51885694 |
| Molecular Formula | C21H26ClN5O4S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 5-[(3aS,4R,6aS)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[(R)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]pentanamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)CCCC[C@@H]1[C@H]2NC(=O)N[C@@H]2CS1(=O)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26ClN5O4S/c1-27-11-10-23-20(27)18(13-6-8-14(22)9-7-13)25-17(28)5-3-2-4-16-19-15(12-32(16,30)31)24-21(29)26-19/h6-11,15-16,18-19H,2-5,12H2,1H3,(H,25,28)(H2,24,26,29)/t15-,16-,18-,19+/m1/s1 |
| InChIKey | REDGLDFJXCDWMG-RWQQGDIJSA-N |
| XLogP | 1.69 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|