C17H20F3N3O5S — CID 124787221
5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-(trifluoromethoxy)phenyl]pentanamide (PubChem CID 124787221) has the molecular formula C17H20F3N3O5S and a molecular weight of 435.42 g/mol. Its IUPAC name is 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-(trifluoromethoxy)phenyl]pentanamide.
| Compound Name | 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-(trifluoromethoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 124787221 |
| Molecular Formula | C17H20F3N3O5S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 5-[(3aS,4R,6aR)-2,5,5-trioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[4-(trifluoromethoxy)phenyl]pentanamide |
| SMILES | O=C(CCCC[C@@H]1[C@H]2NC(=O)N[C@H]2CS1(=O)=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F3N3O5S/c18-17(19,20)28-11-7-5-10(6-8-11)21-14(24)4-2-1-3-13-15-12(9-29(13,26)27)22-16(25)23-15/h5-8,12-13,15H,1-4,9H2,(H,21,24)(H2,22,23,25)/t12-,13+,15-/m0/s1 |
| InChIKey | NSBURZHNRLPWTQ-GUTXKFCHSA-N |
| XLogP | 1.93 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|