C15H10BrF4NO — CID 7920389
N-[4-bromo-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 7920389) has the molecular formula C15H10BrF4NO and a molecular weight of 376.15 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 7920389 |
| Molecular Formula | C15H10BrF4NO |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H10BrF4NO/c16-13-6-5-11(8-12(13)15(18,19)20)21-14(22)7-9-1-3-10(17)4-2-9/h1-6,8H,7H2,(H,21,22) |
| InChIKey | ABNTUQCRJIXFSL-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |