C10H10BrF3N2O2 — CID 66817245
1-[4-bromo-3-(trifluoromethyl)phenyl]-3-(2-hydroxyethyl)urea (PubChem CID 66817245) has the molecular formula C10H10BrF3N2O2 and a molecular weight of 327.10 g/mol. Its IUPAC name is 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-(2-hydroxyethyl)urea.
| Compound Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 66817245 |
| Molecular Formula | C10H10BrF3N2O2 |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-[4-bromo-3-(trifluoromethyl)phenyl]-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10BrF3N2O2/c11-8-2-1-6(5-7(8)10(12,13)14)16-9(18)15-3-4-17/h1-2,5,17H,3-4H2,(H2,15,16,18) |
| InChIKey | WOMFGCPHBRCCNB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |