C11H12F4N2O2 — CID 60597825
1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)urea (PubChem CID 60597825) has the molecular formula C11H12F4N2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 60597825 |
| Molecular Formula | C11H12F4N2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F4N2O2/c12-9-3-2-7(6-8(9)11(13,14)15)17-10(19)16-4-1-5-18/h2-3,6,18H,1,4-5H2,(H2,16,17,19) |
| InChIKey | TUEDCKFKJQFKER-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|