C9H10ClFN2O2 — CID 47238015
1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)urea (PubChem CID 47238015) has the molecular formula C9H10ClFN2O2 and a molecular weight of 232.64 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)urea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 47238015 |
| Molecular Formula | C9H10ClFN2O2 |
| Molecular Weight | 232.64 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCO)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H10ClFN2O2/c10-7-5-6(1-2-8(7)11)13-9(15)12-3-4-14/h1-2,5,14H,3-4H2,(H2,12,13,15) |
| InChIKey | IDUQGJVZIQUHNW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |