C9H8F4N2O — CID 47456942
1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylurea (PubChem CID 47456942) has the molecular formula C9H8F4N2O and a molecular weight of 236.17 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylurea.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylurea |
|---|---|
| PubChem CID | 47456942 |
| Molecular Formula | C9H8F4N2O |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F4N2O/c1-14-8(16)15-5-2-3-7(10)6(4-5)9(11,12)13/h2-4H,1H3,(H2,14,15,16) |
| InChIKey | GYPDKUZOTUFWKR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |