C10H7ClF4N2O2 — CID 61227663
2-chloro-N-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]acetamide (PubChem CID 61227663) has the molecular formula C10H7ClF4N2O2 and a molecular weight of 298.62 g/mol. Its IUPAC name is 2-chloro-N-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]acetamide.
| Compound Name | 2-chloro-N-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]acetamide |
|---|---|
| PubChem CID | 61227663 |
| Molecular Formula | C10H7ClF4N2O2 |
| Molecular Weight | 298.62 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-chloro-N-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoyl]acetamide |
| SMILES | O=C(CCl)NC(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7ClF4N2O2/c11-4-8(18)17-9(19)16-5-1-2-7(12)6(3-5)10(13,14)15/h1-3H,4H2,(H2,16,17,18,19) |
| InChIKey | BJFOKKSIPRKZRR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|