C14H16F4N2O3 — CID 86856293
propan-2-yl 3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]propanoate (PubChem CID 86856293) has the molecular formula C14H16F4N2O3 and a molecular weight of 336.29 g/mol. Its IUPAC name is propan-2-yl 3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]propanoate.
| Compound Name | propan-2-yl 3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 86856293 |
| Molecular Formula | C14H16F4N2O3 |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | propan-2-yl 3-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]propanoate |
| SMILES | CC(C)OC(=O)CCNC(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F4N2O3/c1-8(2)23-12(21)5-6-19-13(22)20-9-3-4-11(15)10(7-9)14(16,17)18/h3-4,7-8H,5-6H2,1-2H3,(H2,19,20,22) |
| InChIKey | QKUHWLDYILVEGI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |