C10H7BrF3NO — CID 13411359
N-[4-bromo-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 13411359) has the molecular formula C10H7BrF3NO and a molecular weight of 294.07 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 13411359 |
| Molecular Formula | C10H7BrF3NO |
| Molecular Weight | 294.07 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H7BrF3NO/c1-2-9(16)15-6-3-4-8(11)7(5-6)10(12,13)14/h2-5H,1H2,(H,15,16) |
| InChIKey | PZDHQJSYGVIDBE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.07 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|