C12H11BrF3NO — CID 42997959
N-[4-bromo-3-(trifluoromethyl)phenyl]-3-methylbut-2-enamide (PubChem CID 42997959) has the molecular formula C12H11BrF3NO and a molecular weight of 322.12 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-3-methylbut-2-enamide.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 42997959 |
| Molecular Formula | C12H11BrF3NO |
| Molecular Weight | 322.12 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11BrF3NO/c1-7(2)5-11(18)17-8-3-4-10(13)9(6-8)12(14,15)16/h3-6H,1-2H3,(H,17,18) |
| InChIKey | BNTFUFKLHKDXKH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.12 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|